Difference between revisions of "Cyclic-Phosphate-Terminated-RNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15318 == * common-name: ** α-d-ribose 5-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1) * inchi-key: ** ktvpxoyakd...")
(Created page with "Category:metabolite == Metabolite CPD-12906 == * common-name: ** 5-methyl-3-oxo-4-hexenoyl-coa * smiles: ** cc(c)=cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(oc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15318 ==
+
== Metabolite CPD-12906 ==
 
* common-name:
 
* common-name:
** α-d-ribose 5-phosphate
+
** 5-methyl-3-oxo-4-hexenoyl-coa
 
* smiles:
 
* smiles:
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1)
+
** cc(c)=cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** ktvpxoyakdprhy-aihaylrmsa-l
+
** zfkzvsujtdsjey-svhodsnwsa-j
 
* molecular-weight:
 
* molecular-weight:
** 228.095
+
** 887.641
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R5PDP]]
+
* [[RXN-11921]]
* [[RPDPK]]
 
* [[RXN-14456]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ARDP]]
 
* [[RIBOKIN-RXN]]
 
* [[RPDPK]]
 
* [[RXN-14456]]
 
* [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-d-ribose 5-phosphate}}
+
{{#set: common-name=5-methyl-3-oxo-4-hexenoyl-coa}}
{{#set: inchi-key=inchikey=ktvpxoyakdprhy-aihaylrmsa-l}}
+
{{#set: inchi-key=inchikey=zfkzvsujtdsjey-svhodsnwsa-j}}
{{#set: molecular-weight=228.095}}
+
{{#set: molecular-weight=887.641}}

Revision as of 13:07, 14 January 2021

Metabolite CPD-12906

  • common-name:
    • 5-methyl-3-oxo-4-hexenoyl-coa
  • smiles:
    • cc(c)=cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • zfkzvsujtdsjey-svhodsnwsa-j
  • molecular-weight:
    • 887.641

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality