Difference between revisions of "Cysteine-Desulfurase-L-cysteine"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18090 == * transcription-direction: ** negative * right-end-position: ** 265781 * left-end-position: ** 265233 * centisome-position: ** 75.26988...") |
(Created page with "Category:metabolite == Metabolite CPD-9646 == * common-name: ** di-trans,octa-cis-undecaprenyl phosphate * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-9646 == |
− | * | + | * common-name: |
− | ** | + | ** di-trans,octa-cis-undecaprenyl phosphate |
− | + | * smiles: | |
− | + | ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])[o-])c)c)c | |
− | + | * inchi-key: | |
− | + | ** ufphfkctoziafy-ntdveaecsa-l | |
− | * | + | * molecular-weight: |
− | ** | + | ** 845.279 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[PHOSNACMURPENTATRANS-RXN]] | |
− | == | + | * [[RXN-11347]] |
− | + | * [[RXN-8975]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-8975]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=di-trans,octa-cis-undecaprenyl phosphate}} | |
− | ** | + | {{#set: inchi-key=inchikey=ufphfkctoziafy-ntdveaecsa-l}} |
− | + | {{#set: molecular-weight=845.279}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:32, 18 December 2020
Contents
Metabolite CPD-9646
- common-name:
- di-trans,octa-cis-undecaprenyl phosphate
- smiles:
- cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])[o-])c)c)c
- inchi-key:
- ufphfkctoziafy-ntdveaecsa-l
- molecular-weight:
- 845.279