Difference between revisions of "Cytidine-34-tRNAIle2"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CROTONYL-COA == * common-name: ** crotonyl-coa * smiles: ** cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(...")
(Created page with "Category:metabolite == Metabolite Cytidine-34-tRNAIle2 == * common-name: ** a cytidine34 in trnaile2 == Reaction(s) known to consume the compound == * RXN-1961 == Reac...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CROTONYL-COA ==
+
== Metabolite Cytidine-34-tRNAIle2 ==
 
* common-name:
 
* common-name:
** crotonyl-coa
+
** a cytidine34 in trnaile2
* smiles:
 
** cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o
 
* inchi-key:
 
** kfwwcmjsysspsk-bogfjhsmsa-j
 
* molecular-weight:
 
** 831.577
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACOAD1f]]
+
* [[RXN-1961]]
* [[ACOAR1h]]
 
* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
 
* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
 
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
 
* [[HBCHL]]
 
* [[HBCHLm]]
 
* [[RXN-11667]]
 
* [[RXN-12558]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACOA40OR]]
 
* [[ACOAD1f]]
 
* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
 
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
 
* [[HBCHL]]
 
* [[HBCHLm]]
 
* [[RXN-11667]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=crotonyl-coa}}
+
{{#set: common-name=a cytidine34 in trnaile2}}
{{#set: inchi-key=inchikey=kfwwcmjsysspsk-bogfjhsmsa-j}}
 
{{#set: molecular-weight=831.577}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite Cytidine-34-tRNAIle2

  • common-name:
    • a cytidine34 in trnaile2

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality