Difference between revisions of "Cytidine-34-tRNAIle2"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ22406 == * transcription-direction: ** positive * right-end-position: ** 3423 * left-end-position: ** 403 * centisome-position: ** 0.22757433 =...")
(Created page with "Category:metabolite == Metabolite CPD-8165 == * common-name: ** 1-18:2-2-18:2-monogalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ22406 ==
+
== Metabolite CPD-8165 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 1-18:2-2-18:2-monogalactosyldiacylglycerol
−
* right-end-position:
+
* smiles:
−
** 3423
+
** cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=cccccc)=o
−
* left-end-position:
+
* inchi-key:
−
** 403
+
** broompuvdptgeg-rhnbirjrsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 0.22757433   
+
** 779.105
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-8366]]
−
== Reaction(s) associated ==
+
* [[RXN-8367]]
−
* [[GLUTKIN-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=1-18:2-2-18:2-monogalactosyldiacylglycerol}}
−
* [[GLUTSEMIALDEHYDROG-RXN]]
+
{{#set: inchi-key=inchikey=broompuvdptgeg-rhnbirjrsa-n}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=779.105}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6922]]
 
−
** '''5''' reactions found over '''7''' reactions in the full pathway
 
−
* [[ARGININE-SYN4-PWY]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-3341]]
 
−
** '''4''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PROSYN-PWY]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
* [[CITRULBIO-PWY]]
 
−
** '''7''' reactions found over '''8''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=3423}}
 
−
{{#set: left-end-position=403}}
 
−
{{#set: centisome-position=0.22757433    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=5}}
 

Revision as of 20:33, 18 December 2020

Metabolite CPD-8165

  • common-name:
    • 1-18:2-2-18:2-monogalactosyldiacylglycerol
  • smiles:
    • cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=cccccc)=o
  • inchi-key:
    • broompuvdptgeg-rhnbirjrsa-n
  • molecular-weight:
    • 779.105

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Cytidine-34-tRNAIle2&oldid=46996"