Difference between revisions of "Cytidine-34-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Fructose-BisPO4-Aldolase-Tri-Me-Lysine == * common-name: ** a [fructose-bisphosphate aldolase]-n6, n6,n6-trimethyl-l-lysine == Reaction(s...")
(Created page with "Category:metabolite == Metabolite CPD-12897 == * common-name: ** 7-methyl-3-oxooct-6-enoyl-coa * smiles: ** cc(c)=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Fructose-BisPO4-Aldolase-Tri-Me-Lysine ==
+
== Metabolite CPD-12897 ==
 
* common-name:
 
* common-name:
** a [fructose-bisphosphate aldolase]-n6, n6,n6-trimethyl-l-lysine
+
** 7-methyl-3-oxooct-6-enoyl-coa
 +
* smiles:
 +
** cc(c)=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** lpmixvanmseery-fueukbnzsa-j
 +
* molecular-weight:
 +
** 915.695
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11917]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13588]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [fructose-bisphosphate aldolase]-n6, n6,n6-trimethyl-l-lysine}}
+
{{#set: common-name=7-methyl-3-oxooct-6-enoyl-coa}}
 +
{{#set: inchi-key=inchikey=lpmixvanmseery-fueukbnzsa-j}}
 +
{{#set: molecular-weight=915.695}}

Revision as of 18:53, 14 January 2021

Metabolite CPD-12897

  • common-name:
    • 7-methyl-3-oxooct-6-enoyl-coa
  • smiles:
    • cc(c)=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • lpmixvanmseery-fueukbnzsa-j
  • molecular-weight:
    • 915.695

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality