Difference between revisions of "Cytochrome-c-N-O-methyl-arginines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17385 == * common-name: ** (6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccccc(sccnc(=o)ccnc(=...")
(Created page with "Category:metabolite == Metabolite TusE-S-sulfanylcysteine == * common-name: ** a [tuse sulfur carrier protein]-s-sulfanylcysteine == Reaction(s) known to consume the compo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17385 ==
+
== Metabolite TusE-S-sulfanylcysteine ==
 
* common-name:
 
* common-name:
** (6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
+
** a [tuse sulfur carrier protein]-s-sulfanylcysteine
* smiles:
 
** ccc=ccc=ccc=ccc=ccc=ccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** krifzirxaaithr-kwfbmmabsa-j
 
* molecular-weight:
 
** 1102.034
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16134]]
+
* [[RXN0-2023]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16132]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}}
+
{{#set: common-name=a [tuse sulfur carrier protein]-s-sulfanylcysteine}}
{{#set: inchi-key=inchikey=krifzirxaaithr-kwfbmmabsa-j}}
 
{{#set: molecular-weight=1102.034}}
 

Revision as of 11:16, 15 January 2021

Metabolite TusE-S-sulfanylcysteine

  • common-name:
    • a [tuse sulfur carrier protein]-s-sulfanylcysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [tuse sulfur carrier protein]-s-sulfanylcysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.