Difference between revisions of "Cytochromes-C-Reduced"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-294 == * common-name: ** 2-maleylacetate * smiles: ** c(=cc(=o)[o-])c(=o)cc([o-])=o * inchi-key: ** soxxpqlizipmiz-uphrsurjsa-l * mol...")
(Created page with "Category:metabolite == Metabolite Cytochromes-C-Reduced == * common-name: ** a reduced c-type cytochrome == Reaction(s) known to consume the compound == * 1.10.2.2-RXN...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-294 ==
+
== Metabolite Cytochromes-C-Reduced ==
 
* common-name:
 
* common-name:
** 2-maleylacetate
+
** a reduced c-type cytochrome
* smiles:
 
** c(=cc(=o)[o-])c(=o)cc([o-])=o
 
* inchi-key:
 
** soxxpqlizipmiz-uphrsurjsa-l
 
* molecular-weight:
 
** 156.095
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1.10.2.2-RXN]]
 +
* [[CYTOCHROME-C-OXIDASE-RXN]]
 +
* [[CYTOCHROME-C-PEROXIDASE-RXN]]
 +
* [[IRON--CYTOCHROME-C-REDUCTASE-RXN]]
 +
* [[NITRITE-REDUCTASE-CYTOCHROME-RXN]]
 +
* [[RXN-15830]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CARBOXYMETHYLENEBUTENOLIDASE-RXN]]
+
* [[1.10.2.2-RXN]]
* [[RXN-9733]]
+
* [[D-LACTATE-DEHYDROGENASE-CYTOCHROME-RXN]]
* [[RXN-9868]]
+
* [[IRON--CYTOCHROME-C-REDUCTASE-RXN]]
 +
* [[RXN-14107]]
 +
* [[RXN-15816]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-maleylacetate}}
+
{{#set: common-name=a reduced c-type cytochrome}}
{{#set: inchi-key=inchikey=soxxpqlizipmiz-uphrsurjsa-l}}
 
{{#set: molecular-weight=156.095}}
 

Latest revision as of 11:17, 18 March 2021