Difference between revisions of "Cytochromes-C-Reduced"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-294 == * common-name: ** 2-maleylacetate * smiles: ** c(=cc(=o)[o-])c(=o)cc([o-])=o * inchi-key: ** soxxpqlizipmiz-uphrsurjsa-l * mol...") |
(Created page with "Category:metabolite == Metabolite Alkyl-acetyl-glycero-phosphocholines == * common-name: ** a 2-acetyl-1-alkyl-sn-glycero-3-phosphocholine == Reaction(s) known to consume...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Alkyl-acetyl-glycero-phosphocholines == |
* common-name: | * common-name: | ||
| − | ** 2- | + | ** a 2-acetyl-1-alkyl-sn-glycero-3-phosphocholine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2.3.1.149-RXN]] | ||
| + | * [[2.3.1.67-RXN]] | ||
| + | * [[3.1.1.47-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.3.1.149-RXN]] |
| − | * [[ | + | * [[2.3.1.67-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=2- | + | {{#set: common-name=a 2-acetyl-1-alkyl-sn-glycero-3-phosphocholine}} |
| − | |||
| − | |||
Revision as of 13:12, 14 January 2021
Contents
Metabolite Alkyl-acetyl-glycero-phosphocholines
- common-name:
- a 2-acetyl-1-alkyl-sn-glycero-3-phosphocholine
