Difference between revisions of "Cytochromes-c"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-611 == * common-name: ** thiamine triphosphate * smiles: ** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=n...")
(Created page with "Category:metabolite == Metabolite Cytochromes-c == * common-name: ** a c-type cytochrome == Reaction(s) known to consume the compound == * [[HOLOCYTOCHROME-C-SYNTHASE-RXN]...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-611 ==
+
== Metabolite Cytochromes-c ==
 
* common-name:
 
* common-name:
** thiamine triphosphate
+
** a c-type cytochrome
* smiles:
 
** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
 
* inchi-key:
 
** iwlrowzyzpnofc-uhfffaoysa-k
 
* molecular-weight:
 
** 501.26
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[THIAMIN-TRIPHOSPHATASE-RXN]]
+
* [[HOLOCYTOCHROME-C-SYNTHASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[HOLOCYTOCHROME-C-SYNTHASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thiamine triphosphate}}
+
{{#set: common-name=a c-type cytochrome}}
{{#set: inchi-key=inchikey=iwlrowzyzpnofc-uhfffaoysa-k}}
 
{{#set: molecular-weight=501.26}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite Cytochromes-c

  • common-name:
    • a c-type cytochrome

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality