Difference between revisions of "Cytosine-34-tRNA-Precursors"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15365 == * common-name: ** densipoloyl-coa * smiles: ** ccc=cccc(o)cc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
(Created page with "Category:metabolite == Metabolite Cytosine-34-tRNA-Precursors == * common-name: ** a cytosine34 in trna precursor == Reaction(s) known to consume the compound == * RXN-1...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15365 ==
+
== Metabolite Cytosine-34-tRNA-Precursors ==
 
* common-name:
 
* common-name:
** densipoloyl-coa
+
** a cytosine34 in trna precursor
* smiles:
 
** ccc=cccc(o)cc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** qebzgoipmjeisg-apevuuacsa-j
 
* molecular-weight:
 
** 1041.936
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16150]]
+
* [[RXN-11856]]
* [[RXN-16153]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16150]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=densipoloyl-coa}}
+
{{#set: common-name=a cytosine34 in trna precursor}}
{{#set: inchi-key=inchikey=qebzgoipmjeisg-apevuuacsa-j}}
 
{{#set: molecular-weight=1041.936}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite Cytosine-34-tRNA-Precursors

  • common-name:
    • a cytosine34 in trna precursor

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality