Difference between revisions of "D-3-HYDROXYACYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17372 == * common-name: ** 1-[18-hydroxyoleyl]-2-lyso-phosphatidate * smiles: ** c(o)cccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o *...") |
(Created page with "Category:metabolite == Metabolite D-3-HYDROXYACYL-COA == * common-name: ** a (3r)-3-hydroxyacyl-coa == Reaction(s) known to consume the compound == * RXN-13279 * RXN...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite D-3-HYDROXYACYL-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** a (3r)-3-hydroxyacyl-coa |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-13279]] |
+ | * [[RXN-17475]] | ||
+ | * [[RXN-7699]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-13279]] |
+ | * [[RXN-17475]] | ||
+ | * [[RXN-7699]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a (3r)-3-hydroxyacyl-coa}} |
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite D-3-HYDROXYACYL-COA
- common-name:
- a (3r)-3-hydroxyacyl-coa