Difference between revisions of "D-3-HYDROXYACYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17372 == * common-name: ** 1-[18-hydroxyoleyl]-2-lyso-phosphatidate * smiles: ** c(o)cccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o *...")
(Created page with "Category:metabolite == Metabolite D-3-HYDROXYACYL-COA == * common-name: ** a (3r)-3-hydroxyacyl-coa == Reaction(s) known to consume the compound == * RXN-13279 * RXN...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17372 ==
+
== Metabolite D-3-HYDROXYACYL-COA ==
 
* common-name:
 
* common-name:
** 1-[18-hydroxyoleyl]-2-lyso-phosphatidate
+
** a (3r)-3-hydroxyacyl-coa
* smiles:
 
** c(o)cccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o
 
* inchi-key:
 
** gfjkjlhwwzxdau-kxfgnqbasa-l
 
* molecular-weight:
 
** 450.508
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16118]]
+
* [[RXN-13279]]
 +
* [[RXN-17475]]
 +
* [[RXN-7699]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16117]]
+
* [[RXN-13279]]
 +
* [[RXN-17475]]
 +
* [[RXN-7699]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-[18-hydroxyoleyl]-2-lyso-phosphatidate}}
+
{{#set: common-name=a (3r)-3-hydroxyacyl-coa}}
{{#set: inchi-key=inchikey=gfjkjlhwwzxdau-kxfgnqbasa-l}}
 
{{#set: molecular-weight=450.508}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite D-3-HYDROXYACYL-COA

  • common-name:
    • a (3r)-3-hydroxyacyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality