Difference between revisions of "D-3-HYDROXYACYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17372 == * common-name: ** 1-[18-hydroxyoleyl]-2-lyso-phosphatidate * smiles: ** c(o)cccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o *...") |
(Created page with "Category:metabolite == Metabolite CPD-335 == * common-name: ** (r)-3-hydroxybutanoate * smiles: ** cc(cc([o-])=o)o * inchi-key: ** whbmmwsbfzvssr-gsvougtgsa-m * molecular-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-335 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-3-hydroxybutanoate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(cc([o-])=o)o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** whbmmwsbfzvssr-gsvougtgsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 103.097 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[3-HYDROXYBUTYRATE-DEHYDROGENASE-RXN]] |
| + | * [[HBNOm]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[3-HYDROXYBUTYRATE-DEHYDROGENASE-RXN]] |
| + | * [[3.1.1.75-RXN]] | ||
| + | * [[HBNOm]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-3-hydroxybutanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=whbmmwsbfzvssr-gsvougtgsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=103.097}} |
Revision as of 13:10, 14 January 2021
Contents
Metabolite CPD-335
- common-name:
- (r)-3-hydroxybutanoate
- smiles:
- cc(cc([o-])=o)o
- inchi-key:
- whbmmwsbfzvssr-gsvougtgsa-m
- molecular-weight:
- 103.097
