Difference between revisions of "D-6-P-GLUCONO-DELTA-LACTONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ALPHA-TOCOPHEROL == * common-name: ** α-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=c(c)c(=c(o1)2)c)c)) * inch...")
(Created page with "Category:metabolite == Metabolite D-6-P-GLUCONO-DELTA-LACTONE == * common-name: ** 6-phospho d-glucono-1,5-lactone * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite ALPHA-TOCOPHEROL ==
+
== Metabolite D-6-P-GLUCONO-DELTA-LACTONE ==
 
* common-name:
 
* common-name:
−
** α-tocopherol
+
** 6-phospho d-glucono-1,5-lactone
 
* smiles:
 
* smiles:
−
** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=c(c)c(=c(o1)2)c)c))
+
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)
 
* inchi-key:
 
* inchi-key:
−
** gvjhhuawpyxkbd-ieosbipesa-n
+
** ijojivndfqsgab-sqougzdysa-l
 
* molecular-weight:
 
* molecular-weight:
−
** 430.713
+
** 256.105
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[6PGLUCONOLACT-RXN]]
 +
* [[RXN-14819]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]]
+
* [[G6PADH]]
 +
* [[G6PADHh]]
 +
* [[G6PBDH]]
 +
* [[G6PBDHh]]
 +
* [[GLU6PDEHYDROG-RXN]]
 +
* [[RXN-14819]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=α-tocopherol}}
+
{{#set: common-name=6-phospho d-glucono-1,5-lactone}}
−
{{#set: inchi-key=inchikey=gvjhhuawpyxkbd-ieosbipesa-n}}
+
{{#set: inchi-key=inchikey=ijojivndfqsgab-sqougzdysa-l}}
−
{{#set: molecular-weight=430.713}}
+
{{#set: molecular-weight=256.105}}

Latest revision as of 11:16, 18 March 2021

Metabolite D-6-P-GLUCONO-DELTA-LACTONE

  • common-name:
    • 6-phospho d-glucono-1,5-lactone
  • smiles:
    • c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)
  • inchi-key:
    • ijojivndfqsgab-sqougzdysa-l
  • molecular-weight:
    • 256.105

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=D-6-P-GLUCONO-DELTA-LACTONE&oldid=138978"