Difference between revisions of "D-6-P-GLUCONO-DELTA-LACTONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FE2GTPabc FE2GTPabc] == * direction: ** left-to-right * common-name: ** ferrous iron uptake (gtp-de...")
(Created page with "Category:metabolite == Metabolite D-6-P-GLUCONO-DELTA-LACTONE == * common-name: ** 6-phospho d-glucono-1,5-lactone * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=FE2GTPabc FE2GTPabc] ==
+
== Metabolite D-6-P-GLUCONO-DELTA-LACTONE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** ferrous iron uptake (gtp-dependent), plasma membrane
+
** 6-phospho d-glucono-1,5-lactone
−
== Reaction formula ==
+
* smiles:
−
* 1.0 [[FE+2]][e] '''+''' 1.0 [[GTP]][c] '''+''' 1.0 [[WATER]][c] '''=>''' 1.0 [[FE+2]][c] '''+''' 1.0 [[GDP]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[Pi]][c]
+
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ13696]]
+
** ijojivndfqsgab-sqougzdysa-l
−
** Category: [[orthology]]
+
* molecular-weight:
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 256.105
−
* Gene: [[SJ06559]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[orthology]]
+
* [[6PGLUCONOLACT-RXN]]
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-14819]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
== Reconstruction information  ==
+
* [[G6PADH]]
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[G6PADHh]]
−
== External links  ==
+
* [[G6PBDH]]
−
{{#set: direction=left-to-right}}
+
* [[G6PBDHh]]
−
{{#set: common-name=ferrous iron uptake (gtp-dependent), plasma membrane}}
+
* [[GLU6PDEHYDROG-RXN]]
−
{{#set: nb gene associated=2}}
+
* [[RXN-14819]]
−
{{#set: nb pathway associated=0}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: reconstruction category=orthology}}
+
{{#set: common-name=6-phospho d-glucono-1,5-lactone}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi-key=inchikey=ijojivndfqsgab-sqougzdysa-l}}
−
{{#set: reconstruction comment=n.a}}
+
{{#set: molecular-weight=256.105}}
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite D-6-P-GLUCONO-DELTA-LACTONE

  • common-name:
    • 6-phospho d-glucono-1,5-lactone
  • smiles:
    • c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)
  • inchi-key:
    • ijojivndfqsgab-sqougzdysa-l
  • molecular-weight:
    • 256.105

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=D-6-P-GLUCONO-DELTA-LACTONE&oldid=138978"