Difference between revisions of "D-6-P-GLUCONO-DELTA-LACTONE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FE2GTPabc FE2GTPabc] == * direction: ** left-to-right * common-name: ** ferrous iron uptake (gtp-de...") |
(Created page with "Category:metabolite == Metabolite D-6-P-GLUCONO-DELTA-LACTONE == * common-name: ** 6-phospho d-glucono-1,5-lactone * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite D-6-P-GLUCONO-DELTA-LACTONE == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 6-phospho d-glucono-1,5-lactone |
− | + | * smiles: | |
− | * | + | ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1) |
− | == | + | * inchi-key: |
− | * | + | ** ijojivndfqsgab-sqougzdysa-l |
− | * | + | * molecular-weight: |
− | * | + | ** 256.105 |
− | * | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[6PGLUCONOLACT-RXN]] |
− | * | + | * [[RXN-14819]] |
− | == | + | == Reaction(s) known to produce the compound == |
− | + | * [[G6PADH]] | |
− | + | * [[G6PADHh]] | |
− | + | * [[G6PBDH]] | |
− | + | * [[G6PBDHh]] | |
− | {{#set: common-name= | + | * [[GLU6PDEHYDROG-RXN]] |
− | {{#set: | + | * [[RXN-14819]] |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: | + | {{#set: common-name=6-phospho d-glucono-1,5-lactone}} |
− | + | {{#set: inchi-key=inchikey=ijojivndfqsgab-sqougzdysa-l}} | |
− | + | {{#set: molecular-weight=256.105}} | |
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite D-6-P-GLUCONO-DELTA-LACTONE
- common-name:
- 6-phospho d-glucono-1,5-lactone
- smiles:
- c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)
- inchi-key:
- ijojivndfqsgab-sqougzdysa-l
- molecular-weight:
- 256.105