Difference between revisions of "D-ALA-D-ALA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10910 RXN-10910] == * direction: ** left-to-right * common-name: ** normetanephrine oxidase * e...")
(Created page with "Category:metabolite == Metabolite D-ALA-D-ALA == * common-name: ** d-alanyl-d-alanine * smiles: ** cc([n+])c(=o)nc(c)c([o-])=o * inchi-key: ** defjqiddeaulhb-qwwzwvqmsa-n...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10910 RXN-10910] ==
+
== Metabolite D-ALA-D-ALA ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** normetanephrine oxidase
+
** d-alanyl-d-alanine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.4.3.4 ec-1.4.3.4]
+
** cc([n+])c(=o)nc(c)c([o-])=o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-11875]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[CPD-11876]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c]
+
** defjqiddeaulhb-qwwzwvqmsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ07831]]
+
** 160.172
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[DALADALALIG-RXN]]
−
* [[PWY-6342]], noradrenaline and adrenaline degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6342 PWY-6342]
+
== Reaction(s) of unknown directionality ==
−
** '''8''' reactions found over '''13''' reactions in the full pathway
+
{{#set: common-name=d-alanyl-d-alanine}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=defjqiddeaulhb-qwwzwvqmsa-n}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=160.172}}
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R04893 R04893]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=normetanephrine oxidase}}
 
−
{{#set: ec-number=ec-1.4.3.4}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite D-ALA-D-ALA

  • common-name:
    • d-alanyl-d-alanine
  • smiles:
    • cc([n+])c(=o)nc(c)c([o-])=o
  • inchi-key:
    • defjqiddeaulhb-qwwzwvqmsa-n
  • molecular-weight:
    • 160.172

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=D-ALA-D-ALA&oldid=138735"