Difference between revisions of "D-ALA-D-ALA"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10910 RXN-10910] == * direction: ** left-to-right * common-name: ** normetanephrine oxidase * e...") |
(Created page with "Category:metabolite == Metabolite D-ALA-D-ALA == * common-name: ** d-alanyl-d-alanine * smiles: ** cc([n+])c(=o)nc(c)c([o-])=o * inchi-key: ** defjqiddeaulhb-qwwzwvqmsa-n...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite D-ALA-D-ALA == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** d-alanyl-d-alanine |
− | * | + | * smiles: |
− | ** [ | + | ** cc([n+])c(=o)nc(c)c([o-])=o |
− | + | * inchi-key: | |
− | + | ** defjqiddeaulhb-qwwzwvqmsa-n | |
− | + | * molecular-weight: | |
− | * | + | ** 160.172 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | ** | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[DALADALALIG-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=d-alanyl-d-alanine}} | |
− | + | {{#set: inchi-key=inchikey=defjqiddeaulhb-qwwzwvqmsa-n}} | |
− | * | + | {{#set: molecular-weight=160.172}} |
− | == | ||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | |||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite D-ALA-D-ALA
- common-name:
- d-alanyl-d-alanine
- smiles:
- cc([n+])c(=o)nc(c)c([o-])=o
- inchi-key:
- defjqiddeaulhb-qwwzwvqmsa-n
- molecular-weight:
- 160.172