Difference between revisions of "D-ALANINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GUANINE == * common-name: ** guanine * smiles: ** c2(=nc1(=c(n=c(nc(=o)1)n)n2)) * inchi-key: ** uytpupdqbnuygx-uhfffaoysa-n * molecular-w...") |
(Created page with "Category:metabolite == Metabolite Methionine-synthase-cob-II-alamins == * common-name: ** a [methionine synthase]-cob(ii)alamin == Reaction(s) known to consume the compoun...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Methionine-synthase-cob-II-alamins == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [methionine synthase]-cob(ii)alamin |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.1.1.135-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [methionine synthase]-cob(ii)alamin}} |
| − | |||
| − | |||
Revision as of 13:10, 14 January 2021
Contents
Metabolite Methionine-synthase-cob-II-alamins
- common-name:
- a [methionine synthase]-cob(ii)alamin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [methionine synthase]-cob(ii)alamin" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
