Difference between revisions of "D-Amino-Acids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE == * common-name: ** 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate * smiles: ** cc(c)=cccc(c)=c...")
(Created page with "Category:metabolite == Metabolite D-Amino-Acids == * common-name: ** a d-amino acid == Reaction(s) known to consume the compound == * AMINO-ACID-RACEMASE-RXN == Reacti...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE ==
+
== Metabolite D-Amino-Acids ==
 
* common-name:
 
* common-name:
** 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate
+
** a d-amino acid
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c
 
* inchi-key:
 
** whmxlrrvaneoog-mvfiekmpsa-l
 
* molecular-weight:
 
** 715.004
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[AMINO-ACID-RACEMASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.5.1.42-RXN]]
+
* [[AMINO-ACID-RACEMASE-RXN]]
 +
* [[RXN-15041]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate}}
+
{{#set: common-name=a d-amino acid}}
{{#set: inchi-key=inchikey=whmxlrrvaneoog-mvfiekmpsa-l}}
 
{{#set: molecular-weight=715.004}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite D-Amino-Acids

  • common-name:
    • a d-amino acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality