Difference between revisions of "D-Amino-Acids"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite INDOLE_ACETATE_AUXIN == * common-name: ** (indol-3-yl)acetate * smiles: ** c([o-])(=o)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** seovtrfcigri...") |
(Created page with "Category:metabolite == Metabolite D-Amino-Acids == * common-name: ** a d-amino acid == Reaction(s) known to consume the compound == * AMINO-ACID-RACEMASE-RXN == Reacti...") |
||
(2 intermediate revisions by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite D-Amino-Acids == |
* common-name: | * common-name: | ||
− | ** | + | ** a d-amino acid |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[AMINO-ACID-RACEMASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[AMINO-ACID-RACEMASE-RXN]] |
− | + | * [[RXN-15041]] | |
− | |||
− | * [[RXN- | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a d-amino acid}} |
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite D-Amino-Acids
- common-name:
- a d-amino acid