Difference between revisions of "D-Amino-Acids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite INDOLE_ACETATE_AUXIN == * common-name: ** (indol-3-yl)acetate * smiles: ** c([o-])(=o)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** seovtrfcigri...")
(Created page with "Category:metabolite == Metabolite D-Amino-Acids == * common-name: ** a d-amino acid == Reaction(s) known to consume the compound == * AMINO-ACID-RACEMASE-RXN == Reacti...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite INDOLE_ACETATE_AUXIN ==
+
== Metabolite D-Amino-Acids ==
 
* common-name:
 
* common-name:
** (indol-3-yl)acetate
+
** a d-amino acid
* smiles:
 
** c([o-])(=o)cc1(=cnc2(c=cc=cc1=2))
 
* inchi-key:
 
** seovtrfcigrimh-uhfffaoysa-m
 
* molecular-weight:
 
** 174.179
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[AMINO-ACID-RACEMASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10711]]
+
* [[AMINO-ACID-RACEMASE-RXN]]
* [[RXN-10715]]
+
* [[RXN-15041]]
* [[RXN-1404]]
 
* [[RXN-5581]]
 
* [[RXNDQC-2]]
 
* [[RXNN-404]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(indol-3-yl)acetate}}
+
{{#set: common-name=a d-amino acid}}
{{#set: inchi-key=inchikey=seovtrfcigrimh-uhfffaoysa-m}}
 
{{#set: molecular-weight=174.179}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite D-Amino-Acids

  • common-name:
    • a d-amino acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality