Difference between revisions of "D-Amino-Acids"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ15728 == * transcription-direction: ** positive * right-end-position: ** 170270 * left-end-position: ** 153009 * centisome-position: ** 52.45459...") |
(Created page with "Category:metabolite == Metabolite BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE == * common-name: ** 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate * smiles: ** cc(c)=cccc(c)=c...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE == |
| − | * | + | * common-name: |
| − | ** | + | ** 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate |
| − | * | + | * smiles: |
| − | ** | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c |
| − | * | + | * inchi-key: |
| − | ** | + | ** whmxlrrvaneoog-mvfiekmpsa-l |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 715.004 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[2.5.1.42-RXN]] |
| − | * [[1 | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate}} | |
| − | + | {{#set: inchi-key=inchikey=whmxlrrvaneoog-mvfiekmpsa-l}} | |
| − | == | + | {{#set: molecular-weight=715.004}} |
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:32, 18 December 2020
Contents
Metabolite BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE
- common-name:
- 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c
- inchi-key:
- whmxlrrvaneoog-mvfiekmpsa-l
- molecular-weight:
- 715.004
