Difference between revisions of "D-CYSTEINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-367 == * common-name: ** (2r)-3-sulfolactate * smiles: ** c(=o)([o-])c(o)cs([o-])(=o)=o * inchi-key: ** cqqgiwjsicouon-reohclbhsa-l *...") |
(Created page with "Category:metabolite == Metabolite D-CYSTEINE == * common-name: ** d-cysteine * smiles: ** c(s)c(c(=o)[o-])[n+] * inchi-key: ** xujnekjlayxesh-uwtatzphsa-n * molecular-weig...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite D-CYSTEINE == |
* common-name: | * common-name: | ||
− | ** | + | ** d-cysteine |
* smiles: | * smiles: | ||
− | ** c( | + | ** c(s)c(c(=o)[o-])[n+] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** xujnekjlayxesh-uwtatzphsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 121.154 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[DCYSDESULF-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=d-cysteine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xujnekjlayxesh-uwtatzphsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=121.154}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite D-CYSTEINE
- common-name:
- d-cysteine
- smiles:
- c(s)c(c(=o)[o-])[n+]
- inchi-key:
- xujnekjlayxesh-uwtatzphsa-n
- molecular-weight:
- 121.154