Difference between revisions of "D-CYSTEINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite HYDROXYMETHYLBILANE == * common-name: ** preuroporphyrinogen * smiles: ** c(o)c1(nc(=c(ccc(=o)[o-])c(cc(=o)[o-])=1)cc2(=c(cc(=o)[o-])c(cc...")
(Created page with "Category:metabolite == Metabolite D-CYSTEINE == * common-name: ** d-cysteine * smiles: ** c(s)c(c(=o)[o-])[n+] * inchi-key: ** xujnekjlayxesh-uwtatzphsa-n * molecular-weig...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite HYDROXYMETHYLBILANE ==
+
== Metabolite D-CYSTEINE ==
 
* common-name:
 
* common-name:
** preuroporphyrinogen
+
** d-cysteine
 
* smiles:
 
* smiles:
** c(o)c1(nc(=c(ccc(=o)[o-])c(cc(=o)[o-])=1)cc2(=c(cc(=o)[o-])c(ccc(=o)[o-])=c(n2)cc4(=c(cc([o-])=o)c(ccc(=o)[o-])=c(cc3(=c(cc([o-])=o)c(ccc(=o)[o-])=cn3))n4)))
+
** c(s)c(c(=o)[o-])[n+]
 
* inchi-key:
 
* inchi-key:
** wdfjyrzcziubpr-uhfffaoysa-f
+
** xujnekjlayxesh-uwtatzphsa-n
 
* molecular-weight:
 
* molecular-weight:
** 846.757
+
** 121.154
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[UROGENIIISYN-RXN]]
+
* [[DCYSDESULF-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[OHMETHYLBILANESYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=preuroporphyrinogen}}
+
{{#set: common-name=d-cysteine}}
{{#set: inchi-key=inchikey=wdfjyrzcziubpr-uhfffaoysa-f}}
+
{{#set: inchi-key=inchikey=xujnekjlayxesh-uwtatzphsa-n}}
{{#set: molecular-weight=846.757}}
+
{{#set: molecular-weight=121.154}}

Latest revision as of 11:13, 18 March 2021

Metabolite D-CYSTEINE

  • common-name:
    • d-cysteine
  • smiles:
    • c(s)c(c(=o)[o-])[n+]
  • inchi-key:
    • xujnekjlayxesh-uwtatzphsa-n
  • molecular-weight:
    • 121.154

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality