Difference between revisions of "D-CYSTEINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DEPHOSPHO-COA == * common-name: ** 3'-dephospho-coa * smiles: ** cc(c)(cop(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)...")
(Created page with "Category:metabolite == Metabolite CPD-4568 == * common-name: ** 14-hydroxylanosterol * smiles: ** cc(c)=cccc([ch]1(c2(c)(c(co)(cc1)c4(=c(cc2)c3([ch](c(c)(c)c(o)cc3)cc4)(c)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DEPHOSPHO-COA ==
+
== Metabolite CPD-4568 ==
 
* common-name:
 
* common-name:
** 3'-dephospho-coa
+
** 14-hydroxylanosterol
 
* smiles:
 
* smiles:
** cc(c)(cop(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))))c(o)c(=o)nccc(=o)nccs
+
** cc(c)=cccc([ch]1(c2(c)(c(co)(cc1)c4(=c(cc2)c3([ch](c(c)(c)c(o)cc3)cc4)(c)))))c
 
* inchi-key:
 
* inchi-key:
** kdtshfargakyjn-ibosznhhsa-l
+
** dwvyykfzedmmpu-puxrvuthsa-n
 
* molecular-weight:
 
* molecular-weight:
** 685.538
+
** 442.724
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ADCPT]]
+
* [[RXN66-304]]
* [[DEPHOSPHOCOAKIN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PANTEPADENYLYLTRAN-RXN]]
+
* [[RXN66-303]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3'-dephospho-coa}}
+
{{#set: common-name=14-hydroxylanosterol}}
{{#set: inchi-key=inchikey=kdtshfargakyjn-ibosznhhsa-l}}
+
{{#set: inchi-key=inchikey=dwvyykfzedmmpu-puxrvuthsa-n}}
{{#set: molecular-weight=685.538}}
+
{{#set: molecular-weight=442.724}}

Revision as of 15:26, 5 January 2021

Metabolite CPD-4568

  • common-name:
    • 14-hydroxylanosterol
  • smiles:
    • cc(c)=cccc([ch]1(c2(c)(c(co)(cc1)c4(=c(cc2)c3([ch](c(c)(c)c(o)cc3)cc4)(c)))))c
  • inchi-key:
    • dwvyykfzedmmpu-puxrvuthsa-n
  • molecular-weight:
    • 442.724

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality