Difference between revisions of "D-ERYTHRO-IMIDAZOLE-GLYCEROL-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ05932 == * transcription-direction: ** negative * right-end-position: ** 68527 * left-end-position: ** 64960 * centisome-position: ** 75.25137...")
 
(Created page with "Category:metabolite == Metabolite D-ERYTHRO-IMIDAZOLE-GLYCEROL-P == * common-name: ** d-erythro-imidazole-glycerol-phosphate * smiles: ** c1(nc=nc=1c(c(o)cop(=o)([o-])[o-]...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ05932 ==
+
== Metabolite D-ERYTHRO-IMIDAZOLE-GLYCEROL-P ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** d-erythro-imidazole-glycerol-phosphate
−
* right-end-position:
+
* smiles:
−
** 68527
+
** c1(nc=nc=1c(c(o)cop(=o)([o-])[o-])o)
−
* left-end-position:
+
* inchi-key:
−
** 64960
+
** hfybthcypkedqq-ritpcoansa-l
−
* centisome-position:
+
* molecular-weight:
−
** 75.25137   
+
** 236.121
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[IGPD]]
−
== Reaction(s) associated ==
+
* [[IMIDPHOSDEHYD-RXN]]
−
* [[2.7.8.23-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[GLUTAMIDOTRANS-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-17900]]
−
* [[ISOCIT-CLEAV-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=d-erythro-imidazole-glycerol-phosphate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=hfybthcypkedqq-ritpcoansa-l}}
−
* [[RXN-10827]]
+
{{#set: molecular-weight=236.121}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-10828]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6969]]
 
−
** '''10''' reactions found over '''12''' reactions in the full pathway
 
−
* [[GLYOXYLATE-BYPASS]]
 
−
** '''6''' reactions found over '''6''' reactions in the full pathway
 
−
* [[P105-PWY]]
 
−
** '''10''' reactions found over '''11''' reactions in the full pathway
 
−
* [[PWY-7769]]
 
−
** '''2''' reactions found over '''25''' reactions in the full pathway
 
−
* [[PWY-6322]]
 
−
** '''2''' reactions found over '''25''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=68527}}
 
−
{{#set: left-end-position=64960}}
 
−
{{#set: centisome-position=75.25137    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=5}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite D-ERYTHRO-IMIDAZOLE-GLYCEROL-P

  • common-name:
    • d-erythro-imidazole-glycerol-phosphate
  • smiles:
    • c1(nc=nc=1c(c(o)cop(=o)([o-])[o-])o)
  • inchi-key:
    • hfybthcypkedqq-ritpcoansa-l
  • molecular-weight:
    • 236.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=D-ERYTHRO-IMIDAZOLE-GLYCEROL-P&oldid=137036"