Difference between revisions of "D-ERYTHRO-IMIDAZOLE-GLYCEROL-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9088 == * smiles: ** ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3...") |
(Created page with "Category:metabolite == Metabolite D-ERYTHRO-IMIDAZOLE-GLYCEROL-P == * common-name: ** d-erythro-imidazole-glycerol-phosphate * smiles: ** c1(nc=nc=1c(c(o)cop(=o)([o-])[o-]...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite D-ERYTHRO-IMIDAZOLE-GLYCEROL-P == |
| + | * common-name: | ||
| + | ** d-erythro-imidazole-glycerol-phosphate | ||
* smiles: | * smiles: | ||
| − | ** | + | ** c1(nc=nc=1c(c(o)cop(=o)([o-])[o-])o) |
| − | * | + | * inchi-key: |
| − | ** | + | ** hfybthcypkedqq-ritpcoansa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 236.121 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[IGPD]] |
| − | * [[RXN | + | * [[IMIDPHOSDEHYD-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[GLUTAMIDOTRANS-RXN]] |
| − | * [[RXN- | + | * [[RXN-17900]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-erythro-imidazole-glycerol-phosphate}} |
| − | {{#set: molecular-weight= | + | {{#set: inchi-key=inchikey=hfybthcypkedqq-ritpcoansa-l}} |
| + | {{#set: molecular-weight=236.121}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite D-ERYTHRO-IMIDAZOLE-GLYCEROL-P
- common-name:
- d-erythro-imidazole-glycerol-phosphate
- smiles:
- c1(nc=nc=1c(c(o)cop(=o)([o-])[o-])o)
- inchi-key:
- hfybthcypkedqq-ritpcoansa-l
- molecular-weight:
- 236.121
