Difference between revisions of "D-GLUCARATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite RNASE-II-DEGRADATION-SUBSTRATE-MRNA == * common-name: ** rnase ii degradation substrate mrna == Reaction(s) known to consume the compound...")
(Created page with "Category:metabolite == Metabolite D-GLUCARATE == * common-name: ** d-glucarate * smiles: ** c(=o)(c(o)c(o)c(o)c(o)c(=o)[o-])[o-] * inchi-key: ** dslzvsrjtyrbfb-lleiaeiesa-...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite RNASE-II-DEGRADATION-SUBSTRATE-MRNA ==
+
== Metabolite D-GLUCARATE ==
 
* common-name:
 
* common-name:
** rnase ii degradation substrate mrna
+
** d-glucarate
 +
* smiles:
 +
** c(=o)(c(o)c(o)c(o)c(o)c(=o)[o-])[o-]
 +
* inchi-key:
 +
** dslzvsrjtyrbfb-lleiaeiesa-l
 +
* molecular-weight:
 +
** 208.124
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.13.1-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14225]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=rnase ii degradation substrate mrna}}
+
{{#set: common-name=d-glucarate}}
 +
{{#set: inchi-key=inchikey=dslzvsrjtyrbfb-lleiaeiesa-l}}
 +
{{#set: molecular-weight=208.124}}

Latest revision as of 11:11, 18 March 2021

Metabolite D-GLUCARATE

  • common-name:
    • d-glucarate
  • smiles:
    • c(=o)(c(o)c(o)c(o)c(o)c(=o)[o-])[o-]
  • inchi-key:
    • dslzvsrjtyrbfb-lleiaeiesa-l
  • molecular-weight:
    • 208.124

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality