Difference between revisions of "D-GLUCARATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ13616 == * transcription-direction: ** positive * right-end-position: ** 137787 * left-end-position: ** 125095 * centisome-position: ** 37.62867...") |
(Created page with "Category:metabolite == Metabolite D-GLUCARATE == * common-name: ** d-glucarate * smiles: ** c(=o)(c(o)c(o)c(o)c(o)c(=o)[o-])[o-] * inchi-key: ** dslzvsrjtyrbfb-lleiaeiesa-...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite D-GLUCARATE == |
| − | * | + | * common-name: |
| − | ** | + | ** d-glucarate |
| − | * | + | * smiles: |
| − | ** | + | ** c(=o)(c(o)c(o)c(o)c(o)c(=o)[o-])[o-] |
| − | * | + | * inchi-key: |
| − | ** | + | ** dslzvsrjtyrbfb-lleiaeiesa-l |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 208.124 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[RXN-14225]] |
| − | * [[RXN- | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=d-glucarate}} | |
| − | + | {{#set: inchi-key=inchikey=dslzvsrjtyrbfb-lleiaeiesa-l}} | |
| − | + | {{#set: molecular-weight=208.124}} | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite D-GLUCARATE
- common-name:
- d-glucarate
- smiles:
- c(=o)(c(o)c(o)c(o)c(o)c(=o)[o-])[o-]
- inchi-key:
- dslzvsrjtyrbfb-lleiaeiesa-l
- molecular-weight:
- 208.124
