Difference between revisions of "D-GLUCARATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite P-COUMAROYL-COA == * common-name: ** 4-coumaroyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2...") |
(Created page with "Category:metabolite == Metabolite D-GLUCARATE == * common-name: ** d-glucarate * smiles: ** c(=o)(c(o)c(o)c(o)c(o)c(=o)[o-])[o-] * inchi-key: ** dslzvsrjtyrbfb-lleiaeiesa-...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite D-GLUCARATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-glucarate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(=o)(c(o)c(o)c(o)c(o)c(=o)[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** dslzvsrjtyrbfb-lleiaeiesa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 208.124 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-14225]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-glucarate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dslzvsrjtyrbfb-lleiaeiesa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=208.124}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite D-GLUCARATE
- common-name:
- d-glucarate
- smiles:
- c(=o)(c(o)c(o)c(o)c(o)c(=o)[o-])[o-]
- inchi-key:
- dslzvsrjtyrbfb-lleiaeiesa-l
- molecular-weight:
- 208.124
