Difference between revisions of "D-GLUCOSAMINE-6-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15675 == * common-name: ** 2-trans-6-trans-tridecadienoyl-coa * smiles: ** ccccccc=cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(...")
(Created page with "Category:metabolite == Metabolite tRNA-pseudouridine-38-39 == * common-name: ** a pseudouridine38/39 in trna == Reaction(s) known to consume the compound == * [[RXN-12727]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15675 ==
+
== Metabolite tRNA-pseudouridine-38-39 ==
 
* common-name:
 
* common-name:
** 2-trans-6-trans-tridecadienoyl-coa
+
** a pseudouridine38/39 in trna
* smiles:
 
** ccccccc=cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** oosdlbaxvxkfib-bjbrngjvsa-j
 
* molecular-weight:
 
** 955.803
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14786]]
+
* [[RXN-12727]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14785]]
+
* [[RXN-12727]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-trans-6-trans-tridecadienoyl-coa}}
+
{{#set: common-name=a pseudouridine38/39 in trna}}
{{#set: inchi-key=inchikey=oosdlbaxvxkfib-bjbrngjvsa-j}}
 
{{#set: molecular-weight=955.803}}
 

Revision as of 14:56, 5 January 2021

Metabolite tRNA-pseudouridine-38-39

  • common-name:
    • a pseudouridine38/39 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality