Difference between revisions of "D-GLUCOSAMINE-6-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-pseudouridine-38-39 == * common-name: ** a pseudouridine38/39 in trna == Reaction(s) known to consume the compound == * [[RXN-12727]...") |
(Created page with "Category:metabolite == Metabolite CPD-13014 == * common-name: ** tributyrin * smiles: ** cccc(occ(oc(ccc)=o)coc(ccc)=o)=o * inchi-key: ** uyxtwwcetriedr-uhfffaoysa-n * mol...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13014 == |
* common-name: | * common-name: | ||
| − | ** | + | ** tributyrin |
| + | * smiles: | ||
| + | ** cccc(occ(oc(ccc)=o)coc(ccc)=o)=o | ||
| + | * inchi-key: | ||
| + | ** uyxtwwcetriedr-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 302.367 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12086]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=tributyrin}} |
| + | {{#set: inchi-key=inchikey=uyxtwwcetriedr-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=302.367}} | ||
Revision as of 15:27, 5 January 2021
Contents
Metabolite CPD-13014
- common-name:
- tributyrin
- smiles:
- cccc(occ(oc(ccc)=o)coc(ccc)=o)=o
- inchi-key:
- uyxtwwcetriedr-uhfffaoysa-n
- molecular-weight:
- 302.367
