Difference between revisions of "D-GLUCURONOLACTONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-474 == * common-name: ** (+)-taxifolin * smiles: ** c1(c=c(o)c(o)=cc=1c2(oc3(c=c([o-])c=c(o)c(c(=o)c(o)2)=3))) * inchi-key: ** cxqwrc...") |
(Created page with "Category:metabolite == Metabolite D-GLUCURONOLACTONE == * common-name: ** d-glucurono-6,3-lactone * smiles: ** c1(=o)(c(o)c(o)[ch](c(o)c=o)o1) * inchi-key: ** uyuxsradsppk...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite D-GLUCURONOLACTONE == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-glucurono-6,3-lactone |
* smiles: | * smiles: | ||
| − | ** c1( | + | ** c1(=o)(c(o)c(o)[ch](c(o)c=o)o1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** uyuxsradsppkrz-sknvomklsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 176.126 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14225]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-glucurono-6,3-lactone}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uyuxsradsppkrz-sknvomklsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=176.126}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite D-GLUCURONOLACTONE
- common-name:
- d-glucurono-6,3-lactone
- smiles:
- c1(=o)(c(o)c(o)[ch](c(o)c=o)o1)
- inchi-key:
- uyuxsradsppkrz-sknvomklsa-n
- molecular-weight:
- 176.126
