Difference between revisions of "D-Glucopyranuronate"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CYS == * common-name: ** l-cysteine * smiles: ** c(s)c(c(=o)[o-])[n+] * inchi-key: ** xujnekjlayxesh-reohclbhsa-n * molecular-weight: **...") |
(Created page with "Category:metabolite == Metabolite CPD-11647 == * common-name: ** thermospermine * smiles: ** c([n+])ccc[n+]ccc[n+]ccc[n+] * inchi-key: ** doddbcgmrafleb-uhfffaoysa-r * mol...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11647 == |
* common-name: | * common-name: | ||
| − | ** | + | ** thermospermine |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c([n+])ccc[n+]ccc[n+]ccc[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** doddbcgmrafleb-uhfffaoysa-r |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 206.374 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-11190]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-11190]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=thermospermine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=doddbcgmrafleb-uhfffaoysa-r}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=206.374}} |
Revision as of 18:59, 14 January 2021
Contents
Metabolite CPD-11647
- common-name:
- thermospermine
- smiles:
- c([n+])ccc[n+]ccc[n+]ccc[n+]
- inchi-key:
- doddbcgmrafleb-uhfffaoysa-r
- molecular-weight:
- 206.374
