Difference between revisions of "D-Glucopyranuronate"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-517 RXN1G-517] == * direction: ** left-to-right * common-name: ** 3-hydroxylignoceroyl-[acyl-...") |
(Created page with "Category:metabolite == Metabolite L-DIHYDROXY-PHENYLALANINE == * common-name: ** l-dopa * smiles: ** c(c(cc1(c=cc(o)=c(o)c=1))[n+])(=o)[o-] * inchi-key: ** wtdrdqbearuvnc-...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite L-DIHYDROXY-PHENYLALANINE == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** l-dopa |
| − | * | + | * smiles: |
| − | ** | + | ** c(c(cc1(c=cc(o)=c(o)c=1))[n+])(=o)[o-] |
| − | == | + | * inchi-key: |
| − | + | ** wtdrdqbearuvnc-lurjtmiesa-n | |
| − | == | + | * molecular-weight: |
| − | * | + | ** 197.19 |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-13061]] |
| − | == | + | * [[RXN-8460]] |
| − | * [[ | + | * [[RXN66-221]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | * [[RXN-5861]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=l-dopa}} | |
| − | + | {{#set: inchi-key=inchikey=wtdrdqbearuvnc-lurjtmiesa-n}} | |
| − | {{#set: common-name= | + | {{#set: molecular-weight=197.19}} |
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Revision as of 20:38, 18 December 2020
Contents
Metabolite L-DIHYDROXY-PHENYLALANINE
- common-name:
- l-dopa
- smiles:
- c(c(cc1(c=cc(o)=c(o)c=1))[n+])(=o)[o-]
- inchi-key:
- wtdrdqbearuvnc-lurjtmiesa-n
- molecular-weight:
- 197.19
