Difference between revisions of "D-HEXOSE-6-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite EDTA == * common-name: ** edta * smiles: ** c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o * inchi-key: ** kcxvzyzypllwcc-uhfff...")
(Created page with "Category:metabolite == Metabolite CPD-8050 == * common-name: ** scyllo-inositol * smiles: ** c1(c(c(c(c(c1o)o)o)o)o)o * inchi-key: ** cdaismweouebre-cdrysyessa-n * molecul...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite EDTA ==
+
== Metabolite CPD-8050 ==
 
* common-name:
 
* common-name:
** edta
+
** scyllo-inositol
 
* smiles:
 
* smiles:
** c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o
+
** c1(c(c(c(c(c1o)o)o)o)o)o
 
* inchi-key:
 
* inchi-key:
** kcxvzyzypllwcc-uhfffaoysa-l
+
** cdaismweouebre-cdrysyessa-n
 
* molecular-weight:
 
* molecular-weight:
** 290.229
+
** 180.157
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ExchangeSeed-EDTA]]
+
* [[RXN-13779]]
* [[TransportSeed-EDTA]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ExchangeSeed-EDTA]]
+
* [[RXN-13779]]
* [[TransportSeed-EDTA]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=edta}}
+
{{#set: common-name=scyllo-inositol}}
{{#set: inchi-key=inchikey=kcxvzyzypllwcc-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=cdaismweouebre-cdrysyessa-n}}
{{#set: molecular-weight=290.229}}
+
{{#set: molecular-weight=180.157}}

Revision as of 08:26, 15 March 2021

Metabolite CPD-8050

  • common-name:
    • scyllo-inositol
  • smiles:
    • c1(c(c(c(c(c1o)o)o)o)o)o
  • inchi-key:
    • cdaismweouebre-cdrysyessa-n
  • molecular-weight:
    • 180.157

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality