Difference between revisions of "D-HEXOSE-6-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18680 == * transcription-direction: ** negative * right-end-position: ** 88546 * left-end-position: ** 80853 * centisome-position: ** 33.818527...") |
(Created page with "Category:metabolite == Metabolite D-HEXOSE-6-PHOSPHATE == * common-name: ** d-hexose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** nbs...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite D-HEXOSE-6-PHOSPHATE == |
− | * | + | * common-name: |
− | ** | + | ** d-hexose 6-phosphate |
− | * | + | * smiles: |
− | ** | + | ** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1) |
− | * | + | * inchi-key: |
− | ** | + | ** nbschqhzlsjfnq-uhfffaoysa-l |
− | * | + | * molecular-weight: |
− | ** | + | ** 258.121 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[HEXOKINASE-RXN]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=d-hexose 6-phosphate}} | |
− | + | {{#set: inchi-key=inchikey=nbschqhzlsjfnq-uhfffaoysa-l}} | |
− | + | {{#set: molecular-weight=258.121}} | |
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite D-HEXOSE-6-PHOSPHATE
- common-name:
- d-hexose 6-phosphate
- smiles:
- c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1)
- inchi-key:
- nbschqhzlsjfnq-uhfffaoysa-l
- molecular-weight:
- 258.121