Difference between revisions of "D-Hexoses"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PYRIDOXINE-5P == * common-name: ** pyridoxine 5'-phosphate * smiles: ** cc1(=nc=c(cop([o-])(=o)[o-])c(=c(o)1)co) * inchi-key: ** whomfkwh...") |
(Created page with "Category:metabolite == Metabolite Deoxyhypusine-Synthase-Lysine == * common-name: ** a [deoxyhypusine synthase]-l-lysine == Reaction(s) known to consume the compound == *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Deoxyhypusine-Synthase-Lysine == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [deoxyhypusine synthase]-l-lysine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-13415]] | |
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-13416]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [deoxyhypusine synthase]-l-lysine}} |
| − | |||
| − | |||
Revision as of 11:19, 15 January 2021
Contents
Metabolite Deoxyhypusine-Synthase-Lysine
- common-name:
- a [deoxyhypusine synthase]-l-lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [deoxyhypusine synthase]-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
