Difference between revisions of "D-METHYL-MALONYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-24185 == == Reaction(s) known to consume the compound == * RXN-22198 == Reaction(s) known to produce the compound == * RXN-2220...") |
(Created page with "Category:metabolite == Metabolite D-METHYL-MALONYL-COA == * common-name: ** (s)-methylmalonyl-coa * smiles: ** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite D-METHYL-MALONYL-COA == |
+ | * common-name: | ||
+ | ** (s)-methylmalonyl-coa | ||
+ | * smiles: | ||
+ | ** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c([o-])=o | ||
+ | * inchi-key: | ||
+ | ** mzfokikepguzen-ibnuzsncsa-i | ||
+ | * molecular-weight: | ||
+ | ** 862.568 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[METHYLMALONYL-COA-DECARBOXYLASE-RXN]] |
+ | * [[PROPIONYL-COA-CARBOXY-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[METHYLMALONYL-COA-DECARBOXYLASE-RXN]] |
+ | * [[PROPIONYL-COA-CARBOXY-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=(s)-methylmalonyl-coa}} | ||
+ | {{#set: inchi-key=inchikey=mzfokikepguzen-ibnuzsncsa-i}} | ||
+ | {{#set: molecular-weight=862.568}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite D-METHYL-MALONYL-COA
- common-name:
- (s)-methylmalonyl-coa
- smiles:
- cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c([o-])=o
- inchi-key:
- mzfokikepguzen-ibnuzsncsa-i
- molecular-weight:
- 862.568