Difference between revisions of "D-METHYL-MALONYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ10465 == * transcription-direction: ** positive * right-end-position: ** 26240 * left-end-position: ** 23025 * centisome-position: ** 77.08661...")
(Created page with "Category:metabolite == Metabolite D-METHYL-MALONYL-COA == * common-name: ** (s)-methylmalonyl-coa * smiles: ** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ10465 ==
+
== Metabolite D-METHYL-MALONYL-COA ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** (s)-methylmalonyl-coa
−
* right-end-position:
+
* smiles:
−
** 26240
+
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 23025
+
** mzfokikepguzen-ibnuzsncsa-i
−
* centisome-position:
+
* molecular-weight:
−
** 77.08661   
+
** 862.568
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[METHYLMALONYL-COA-DECARBOXYLASE-RXN]]
−
== Reaction(s) associated ==
+
* [[PROPIONYL-COA-CARBOXY-RXN]]
−
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[METHYLMALONYL-COA-DECARBOXYLASE-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[PROPIONYL-COA-CARBOXY-RXN]]
−
* [[RR-BUTANEDIOL-DEHYDROGENASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=(s)-methylmalonyl-coa}}
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=mzfokikepguzen-ibnuzsncsa-i}}
−
== Pathway(s) associated ==
+
{{#set: molecular-weight=862.568}}
−
* [[PWY-5951]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
* [[PWY3O-246]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=26240}}
 
−
{{#set: left-end-position=23025}}
 
−
{{#set: centisome-position=77.08661    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite D-METHYL-MALONYL-COA

  • common-name:
    • (s)-methylmalonyl-coa
  • smiles:
    • cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c([o-])=o
  • inchi-key:
    • mzfokikepguzen-ibnuzsncsa-i
  • molecular-weight:
    • 862.568

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=D-METHYL-MALONYL-COA&oldid=137114"