Difference between revisions of "D-METHYL-MALONYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-FORMIMINO-AICAR-P == * common-name: ** 1-(5-phospho-β-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole...")
(Created page with "Category:metabolite == Metabolite tRNA-uridine-38-40 == * common-name: ** a uridine38-40 in trna == Reaction(s) known to consume the compound == * TRNA-PSEUDOURIDINE-SYN...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite PHOSPHORIBOSYL-FORMIMINO-AICAR-P ==
+
== Metabolite tRNA-uridine-38-40 ==
 
* common-name:
 
* common-name:
−
** 1-(5-phospho-β-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide
+
** a uridine38-40 in trna
−
* smiles:
 
−
** c(nc1(oc(cop([o-])(=o)[o-])c(o)c(o)1))=nc3(=c(c(n)=o)n=cn(c2(oc(cop([o-])(=o)[o-])c(o)c(o)2))3)
 
−
* inchi-key:
 
−
** qoushgmtbiiahr-keohhstqsa-j
 
−
* molecular-weight:
 
−
** 573.303
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[PRIBFAICARPISOM-RXN]]
+
* [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
−
* [[PRICI]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[HISTCYCLOHYD-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=1-(5-phospho-β-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide}}
+
{{#set: common-name=a uridine38-40 in trna}}
−
{{#set: inchi-key=inchikey=qoushgmtbiiahr-keohhstqsa-j}}
 
−
{{#set: molecular-weight=573.303}}
 

Revision as of 13:08, 14 January 2021

Metabolite tRNA-uridine-38-40

  • common-name:
    • a uridine38-40 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=D-METHYL-MALONYL-COA&oldid=85013"