Difference between revisions of "D-METHYL-MALONYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-uridine-38-40 == * common-name: ** a uridine38-40 in trna == Reaction(s) known to consume the compound == * TRNA-PSEUDOURIDINE-SYN...") |
(Created page with "Category:metabolite == Metabolite BILIVERDINE == * common-name: ** biliverdin-ix-α * smiles: ** c=cc1(c(nc(c(c)=1)=o)=cc4(=c(c)c(=c(c=c3(n=c(c=c2(c(c)=c(c=c)c(n2)=o)...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite BILIVERDINE == |
* common-name: | * common-name: | ||
− | ** | + | ** biliverdin-ix-α |
+ | * smiles: | ||
+ | ** c=cc1(c(nc(c(c)=1)=o)=cc4(=c(c)c(=c(c=c3(n=c(c=c2(c(c)=c(c=c)c(n2)=o))c(c)=c3ccc([o-])=o))n4)ccc([o-])=o)) | ||
+ | * inchi-key: | ||
+ | ** qbuvfdktzjnupp-msgwkzgbsa-l | ||
+ | * molecular-weight: | ||
+ | ** 580.639 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[1.3.7.2-RXN]] |
+ | * [[1.3.7.4-RXN]] | ||
+ | * [[R05818]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[HEME-OXYGENASE-DECYCLIZING-RXN]] | ||
+ | * [[R05818]] | ||
+ | * [[RXN-17523]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=biliverdin-ix-α}} |
+ | {{#set: inchi-key=inchikey=qbuvfdktzjnupp-msgwkzgbsa-l}} | ||
+ | {{#set: molecular-weight=580.639}} |
Revision as of 18:53, 14 January 2021
Contents
Metabolite BILIVERDINE
- common-name:
- biliverdin-ix-α
- smiles:
- c=cc1(c(nc(c(c)=1)=o)=cc4(=c(c)c(=c(c=c3(n=c(c=c2(c(c)=c(c=c)c(n2)=o))c(c)=c3ccc([o-])=o))n4)ccc([o-])=o))
- inchi-key:
- qbuvfdktzjnupp-msgwkzgbsa-l
- molecular-weight:
- 580.639