Difference between revisions of "D-MYO-INOSITOL-1-MONOPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ03663 == * transcription-direction: ** negative * right-end-position: ** 419002 * left-end-position: ** 413065 * centisome-position: ** 79.17111...")
(Created page with "Category:metabolite == Metabolite D-MYO-INOSITOL-1-MONOPHOSPHATE == * common-name: ** 1d-myo-inositol 1-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(o)c(o...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ03663 ==
+
== Metabolite D-MYO-INOSITOL-1-MONOPHOSPHATE ==
* transcription-direction:
+
* common-name:
** negative
+
** 1d-myo-inositol 1-monophosphate
* right-end-position:
+
* smiles:
** 419002
+
** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(o)c(o)1)
* left-end-position:
+
* inchi-key:
** 413065
+
** inapmgsxuvuwaf-uotptpdrsa-l
* centisome-position:
+
* molecular-weight:
** 79.17111   
+
** 258.121
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-16261]]
== Reaction(s) associated ==
+
* [[RXN0-5408]]
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to produce the compound ==
* [[HEMN-RXN]]
+
* [[RXN-16261]]
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=1d-myo-inositol 1-monophosphate}}
* [[RXN-14950]]
+
{{#set: inchi-key=inchikey=inapmgsxuvuwaf-uotptpdrsa-l}}
** Category: [[annotation]]
+
{{#set: molecular-weight=258.121}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-14957]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-14959]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-17127]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-8654]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-8655]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN0-949]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
</div>
 
== Pathway(s) associated ==
 
* [[PWY-5531]]
 
** '''4''' reactions found over '''9''' reactions in the full pathway
 
* [[HEMESYN2-PWY]]
 
** '''3''' reactions found over '''4''' reactions in the full pathway
 
* [[PWY-7382]]
 
** '''4''' reactions found over '''7''' reactions in the full pathway
 
* [[PWY0-522]]
 
** '''2''' reactions found over '''2''' reactions in the full pathway
 
* [[PWY-6984]]
 
** '''2''' reactions found over '''4''' reactions in the full pathway
 
* [[PWY0-1275]]
 
** '''2''' reactions found over '''2''' reactions in the full pathway
 
* [[PWY0-501]]
 
** '''2''' reactions found over '''2''' reactions in the full pathway
 
* [[PWY-6987]]
 
** '''2''' reactions found over '''3''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=419002}}
 
{{#set: left-end-position=413065}}
 
{{#set: centisome-position=79.17111    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=8}}
 
{{#set: nb pathway associated=8}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite D-MYO-INOSITOL-1-MONOPHOSPHATE

  • common-name:
    • 1d-myo-inositol 1-monophosphate
  • smiles:
    • c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(o)c(o)1)
  • inchi-key:
    • inapmgsxuvuwaf-uotptpdrsa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality