Difference between revisions of "D-MYO-INOSITOL-1-MONOPHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ03663 == * transcription-direction: ** negative * right-end-position: ** 419002 * left-end-position: ** 413065 * centisome-position: ** 79.17111...") |
(Created page with "Category:metabolite == Metabolite D-MYO-INOSITOL-1-MONOPHOSPHATE == * common-name: ** 1d-myo-inositol 1-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(o)c(o...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite D-MYO-INOSITOL-1-MONOPHOSPHATE == |
− | * | + | * common-name: |
− | ** | + | ** 1d-myo-inositol 1-monophosphate |
− | + | * smiles: | |
− | + | ** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(o)c(o)1) | |
− | + | * inchi-key: | |
− | * | + | ** inapmgsxuvuwaf-uotptpdrsa-l |
− | + | * molecular-weight: | |
− | ** | + | ** 258.121 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[RXN-16261]] | |
− | + | * [[RXN0-5408]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-16261]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=1d-myo-inositol 1-monophosphate}} | |
− | + | {{#set: inchi-key=inchikey=inapmgsxuvuwaf-uotptpdrsa-l}} | |
− | + | {{#set: molecular-weight=258.121}} | |
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | * [[RXN0- | ||
− | |||
− | |||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite D-MYO-INOSITOL-1-MONOPHOSPHATE
- common-name:
- 1d-myo-inositol 1-monophosphate
- smiles:
- c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(o)c(o)1)
- inchi-key:
- inapmgsxuvuwaf-uotptpdrsa-l
- molecular-weight:
- 258.121