Difference between revisions of "D-MYO-INOSITOL-13-BISPHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-316 == * common-name: ** reduced riboflavin * smiles: ** cc1(=c(c=c2(c(=c1)nc3(c(n2cc(o)c(o)c(o)co)=nc(nc3=o)=o)))c) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite GLYCERATE == * common-name: ** d-glycerate * smiles: ** c(=o)([o-])c(o)co * inchi-key: ** rbnpomfgqqghho-uwtatzphsa-m * molecular-weight:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GLYCERATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-glycerate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(=o)([o-])c(o)co |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rbnpomfgqqghho-uwtatzphsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 105.07 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[GLY3KIN-RXN]] | ||
| + | * [[HYDROXYPYRUVATE-REDUCTASE-RXN]] | ||
| + | * [[RXN-15115]] | ||
| + | * [[RXN0-5289]] | ||
| + | * [[biomass_rxn]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[HYDROXYPYRUVATE-REDUCTASE-RXN]] |
| − | * [[RXN- | + | * [[RXN-15115]] |
| + | * [[RXN0-5289]] | ||
| + | * [[TSA-REDUCT-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-glycerate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rbnpomfgqqghho-uwtatzphsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=105.07}} |
Revision as of 08:30, 15 March 2021
Contents
Metabolite GLYCERATE
- common-name:
- d-glycerate
- smiles:
- c(=o)([o-])c(o)co
- inchi-key:
- rbnpomfgqqghho-uwtatzphsa-m
- molecular-weight:
- 105.07
