|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PMPOXI-RXN PMPOXI-RXN] == | + | == Metabolite D-MYO-INOSITOL-34-BISPHOSPHATE == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** pyridoxamine 5'-phosphate oxidase | + | ** d-myo-inositol (3,4)-bisphosphate |
| − | ** pyridoxamine-phosphate oxidase
| + | * smiles: |
| − | * ec-number: | + | ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)1) |
| − | ** [http://enzyme.expasy.org/EC/1.4.3.5 ec-1.4.3.5] | + | * inchi-key: |
| − | == Reaction formula == | + | ** mckajxmrulsuki-cnwjwelysa-j |
| − | * 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[PYRIDOXAMINE-5P]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[PYRIDOXAL_PHOSPHATE]][c]
| + | * molecular-weight: |
| − | == Gene(s) associated with this reaction ==
| + | ** 336.085 |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) known to consume the compound == |
| − | * Gene: [[SJ08123]] | + | * [[RXN-10960]] |
| − | ** Category: [[annotation]]
| + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | * [[RXN-10939]] |
| − | ** Category: [[orthology]]
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: common-name=d-myo-inositol (3,4)-bisphosphate}} |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | {{#set: inchi-key=inchikey=mckajxmrulsuki-cnwjwelysa-j}} |
| − | * Gene: [[SJ18666]]
| + | {{#set: molecular-weight=336.085}} |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ21118]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ03655]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | ** Category: [[orthology]] | |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ01932]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | * [[PLPSAL-PWY]], pyridoxal 5'-phosphate salvage I: [http://metacyc.org/META/NEW-IMAGE?object=PLPSAL-PWY PLPSAL-PWY] | |
| − | ** '''5''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-7204]], pyridoxal 5'-phosphate salvage II (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7204 PWY-7204]
| |
| − | ** '''9''' reactions found over '''9''' reactions in the full pathway
| |
| − | == Reconstruction information == | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15818 15818]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R00277 R00277]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P0AFI7 P0AFI7]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JTZ1 Q9JTZ1]
| |
| − | ** [http://www.uniprot.org/uniprot/P44909 P44909]
| |
| − | ** [http://www.uniprot.org/uniprot/P38075 P38075]
| |
| − | ** [http://www.uniprot.org/uniprot/P74211 P74211]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=pyridoxamine 5'-phosphate oxidase|pyridoxamine-phosphate oxidase}} | |
| − | {{#set: ec-number=ec-1.4.3.5}} | |
| − | {{#set: nb gene associated=5}} | |
| − | {{#set: nb pathway associated=2}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome|output_pantograph_nannochloropsis_salina}}
| |
