Difference between revisions of "D-MYO-INOSITOL-34-BISPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8790 RXN-8790] == * direction: ** reversible * common-name: ** dihydrogeranylgeranyl-bacterioch...")
 
(Created page with "Category:metabolite == Metabolite D-MYO-INOSITOL-34-BISPHOSPHATE == * common-name: ** d-myo-inositol (3,4)-bisphosphate * smiles: ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(op(...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8790 RXN-8790] ==
+
== Metabolite D-MYO-INOSITOL-34-BISPHOSPHATE ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** dihydrogeranylgeranyl-bacteriochlorophyll a reductase
+
** d-myo-inositol (3,4)-bisphosphate
−
== Reaction formula ==
+
* smiles:
−
* 1 [[CPD-9090]][c] '''+''' 1 [[NADP]][c] '''<=>''' 1 [[CPD-9089]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c]
+
** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)1)
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ15264]]
+
** mckajxmrulsuki-cnwjwelysa-j
−
** Category: [[annotation]]
+
* molecular-weight:
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
** 336.085
−
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
−
* [[PWY-5526]], bacteriochlorophyll a biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5526 PWY-5526]
+
* [[RXN-10960]]
−
** '''5''' reactions found over '''13''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
== Reconstruction information  ==
+
* [[RXN-10939]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== External links  ==
+
{{#set: common-name=d-myo-inositol (3,4)-bisphosphate}}
−
{{#set: direction=reversible}}
+
{{#set: inchi-key=inchikey=mckajxmrulsuki-cnwjwelysa-j}}
−
{{#set: common-name=dihydrogeranylgeranyl-bacteriochlorophyll a reductase}}
+
{{#set: molecular-weight=336.085}}
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite D-MYO-INOSITOL-34-BISPHOSPHATE

  • common-name:
    • d-myo-inositol (3,4)-bisphosphate
  • smiles:
    • c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)1)
  • inchi-key:
    • mckajxmrulsuki-cnwjwelysa-j
  • molecular-weight:
    • 336.085

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=D-MYO-INOSITOL-34-BISPHOSPHATE&oldid=139753"