Difference between revisions of "D-MYO-INOSITOL-4-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-218 RXN3O-218] == * direction: ** left-to-right * common-name: ** epi-sterol-desaturase * ec-...")
(Created page with "Category:metabolite == Metabolite CARNITINE == * common-name: ** l-carnitine * smiles: ** c(c(o)cc(=o)[o-])[n+](c)(c)c * inchi-key: ** phiqhxfuzvpyii-zcfiwibfsa-n * molecu...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-218 RXN3O-218] ==
+
== Metabolite CARNITINE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** epi-sterol-desaturase
+
** l-carnitine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.14.19.20 ec-1.14.19.20]
+
** c(c(o)cc(=o)[o-])[n+](c)(c)c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[EPISTEROL]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[PROTON]][c] '''=>''' 1 [[CPD-700]][c] '''+''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 2 [[WATER]][c]
+
** phiqhxfuzvpyii-zcfiwibfsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ11625]]
+
** 161.2
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
−
** Category: [[orthology]]
+
* [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]]
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-9918]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ00834]]
+
* [[1.14.11.1-RXN]]
−
** Category: [[annotation]]
+
* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]]
−
== Pathway(s) ==
+
* [[RXN-9918]]
−
* [[PWY-2541]], phytosterol biosynthesis (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-2541 PWY-2541]
+
== Reaction(s) of unknown directionality ==
−
** '''11''' reactions found over '''35''' reactions in the full pathway
+
{{#set: common-name=l-carnitine}}
−
* [[PWY-6075]], ergosterol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6075 PWY-6075]
+
{{#set: inchi-key=inchikey=phiqhxfuzvpyii-zcfiwibfsa-n}}
−
** '''3''' reactions found over '''5''' reactions in the full pathway
+
{{#set: molecular-weight=161.2}}
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=33464 33464]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R07505 R07505]
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R07491 R07491]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=epi-sterol-desaturase}}
 
−
{{#set: ec-number=ec-1.14.19.20}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome|output_pantograph_arabidopsis_thaliana}}
 

Revision as of 20:38, 18 December 2020

Metabolite CARNITINE

  • common-name:
    • l-carnitine
  • smiles:
    • c(c(o)cc(=o)[o-])[n+](c)(c)c
  • inchi-key:
    • phiqhxfuzvpyii-zcfiwibfsa-n
  • molecular-weight:
    • 161.2

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=D-MYO-INOSITOL-4-PHOSPHATE&oldid=48660"