Difference between revisions of "D-RIBULOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE == * common-name: ** n1-(5-phospho-β-d-ribosyl)glycinamide * smiles: ** c([n+])c(=o)nc1(c(o)c(o)c(cop...")
(Created page with "Category:metabolite == Metabolite Myelin-N-o-methyl-arginines == * common-name: ** [myelin basic protein]-nω-methyl-arginine == Reaction(s) known to consume the comp...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE ==
+
== Metabolite Myelin-N-o-methyl-arginines ==
 
* common-name:
 
* common-name:
** n1-(5-phospho-β-d-ribosyl)glycinamide
+
** [myelin basic protein]-nω-methyl-arginine
* smiles:
 
** c([n+])c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
 
* inchi-key:
 
** obqmlsfouzuiob-shuuezrqsa-m
 
* molecular-weight:
 
** 285.17
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FPGFTh]]
 
* [[GART-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[FGFTh]]
+
* [[2.1.1.126-RXN]]
* [[FPGFTh]]
 
* [[GART-RXN]]
 
* [[GLYRIBONUCSYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n1-(5-phospho-β-d-ribosyl)glycinamide}}
+
{{#set: common-name=[myelin basic protein]-nω-methyl-arginine}}
{{#set: inchi-key=inchikey=obqmlsfouzuiob-shuuezrqsa-m}}
 
{{#set: molecular-weight=285.17}}
 

Revision as of 08:29, 15 March 2021

Metabolite Myelin-N-o-methyl-arginines

  • common-name:
    • [myelin basic protein]-nω-methyl-arginine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "myelin basic protein]-nω-methyl-arginine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.