Difference between revisions of "D-RIBULOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite NMNH == * common-name: ** reduced β-nicotinamide d-ribonucleotide * smiles: ** c1(=c(cc=cn1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2))c(n)=o...")
(Created page with "Category:metabolite == Metabolite D-RIBULOSE == * common-name: ** d-ribulose * smiles: ** c(o)c(o)c(o)c(=o)co * inchi-key: ** zaqjhhrnxzubte-nqxxgfsbsa-n * molecular-weigh...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite NMNH ==
+
== Metabolite D-RIBULOSE ==
 
* common-name:
 
* common-name:
** reduced β-nicotinamide d-ribonucleotide
+
** d-ribulose
 
* smiles:
 
* smiles:
** c1(=c(cc=cn1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2))c(n)=o)
+
** c(o)c(o)c(o)c(=o)co
 
* inchi-key:
 
* inchi-key:
** xqhmusrslnrvga-turqnecasa-l
+
** zaqjhhrnxzubte-nqxxgfsbsa-n
 
* molecular-weight:
 
* molecular-weight:
** 334.222
+
** 150.131
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RIBITOL-2-DEHYDROGENASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-4401]]
+
* [[RIBITOL-2-DEHYDROGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=reduced β-nicotinamide d-ribonucleotide}}
+
{{#set: common-name=d-ribulose}}
{{#set: inchi-key=inchikey=xqhmusrslnrvga-turqnecasa-l}}
+
{{#set: inchi-key=inchikey=zaqjhhrnxzubte-nqxxgfsbsa-n}}
{{#set: molecular-weight=334.222}}
+
{{#set: molecular-weight=150.131}}

Latest revision as of 11:15, 18 March 2021

Metabolite D-RIBULOSE

  • common-name:
    • d-ribulose
  • smiles:
    • c(o)c(o)c(o)c(=o)co
  • inchi-key:
    • zaqjhhrnxzubte-nqxxgfsbsa-n
  • molecular-weight:
    • 150.131

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality