Difference between revisions of "D-RIBULOSE-15-P2"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ07198 == * transcription-direction: ** positive * right-end-position: ** 590512 * left-end-position: ** 580482 * centisome-position: ** 39.729763...")
(Created page with "Category:metabolite == Metabolite D-RIBULOSE-15-P2 == * common-name: ** d-ribulose-1,5-bisphosphate * smiles: ** c(op([o-])([o-])=o)c(o)c(o)c(=o)cop(=o)([o-])[o-] * inchi-...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ07198 ==
+
== Metabolite D-RIBULOSE-15-P2 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** d-ribulose-1,5-bisphosphate
−
* right-end-position:
+
* smiles:
−
** 590512
+
** c(op([o-])([o-])=o)c(o)c(o)c(=o)cop(=o)([o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 580482
+
** yahzabjorduqgo-nqxxgfsbsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 39.729763   
+
** 306.059
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[PHOSPHORIBULOKINASE-RXN]]
−
== Reaction(s) associated ==
+
* [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]]
−
* [[RXN-10039]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[PHOSPHORIBULOKINASE-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=d-ribulose-1,5-bisphosphate}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=yahzabjorduqgo-nqxxgfsbsa-j}}
−
== Pathway(s) associated ==
+
{{#set: molecular-weight=306.059}}
−
* [[PWY-6281]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=590512}}
 
−
{{#set: left-end-position=580482}}
 
−
{{#set: centisome-position=39.729763    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite D-RIBULOSE-15-P2

  • common-name:
    • d-ribulose-1,5-bisphosphate
  • smiles:
    • c(op([o-])([o-])=o)c(o)c(o)c(=o)cop(=o)([o-])[o-]
  • inchi-key:
    • yahzabjorduqgo-nqxxgfsbsa-j
  • molecular-weight:
    • 306.059

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=D-RIBULOSE-15-P2&oldid=136922"