Difference between revisions of "D-RIBULOSE-15-P2"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9090 == * smiles: ** ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4...") |
(Created page with "Category:metabolite == Metabolite D-RIBULOSE-15-P2 == * common-name: ** d-ribulose-1,5-bisphosphate * smiles: ** c(op([o-])([o-])=o)c(o)c(o)c(=o)cop(=o)([o-])[o-] * inchi-...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite D-RIBULOSE-15-P2 == |
| + | * common-name: | ||
| + | ** d-ribulose-1,5-bisphosphate | ||
* smiles: | * smiles: | ||
| − | ** | + | ** c(op([o-])([o-])=o)c(o)c(o)c(=o)cop(=o)([o-])[o-] |
| − | * | + | * inchi-key: |
| − | ** | + | ** yahzabjorduqgo-nqxxgfsbsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 306.059 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[PHOSPHORIBULOKINASE-RXN]] |
| − | * [[RXN | + | * [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PHOSPHORIBULOKINASE-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-ribulose-1,5-bisphosphate}} |
| − | {{#set: molecular-weight= | + | {{#set: inchi-key=inchikey=yahzabjorduqgo-nqxxgfsbsa-j}} |
| + | {{#set: molecular-weight=306.059}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite D-RIBULOSE-15-P2
- common-name:
- d-ribulose-1,5-bisphosphate
- smiles:
- c(op([o-])([o-])=o)c(o)c(o)c(=o)cop(=o)([o-])[o-]
- inchi-key:
- yahzabjorduqgo-nqxxgfsbsa-j
- molecular-weight:
- 306.059
