Difference between revisions of "D-Ribofuranose"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14873 == * common-name: ** 3-amino-4-hydroxybenzoate * smiles: ** c(=o)([o-])c1(c=c(n)c(o)=cc=1) * inchi-key: ** mrbkrzapgucwos-uhfff...") |
(Created page with "Category:metabolite == Metabolite D-Ribofuranose == * common-name: ** d-ribofuranose == Reaction(s) known to consume the compound == * RXN-4315 == Reaction(s) known to...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite D-Ribofuranose == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-ribofuranose |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-4315]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[PURINE-NUCLEOSIDASE-RXN]] | ||
| + | * [[RIBOSYLPYRIMIDINE-NUCLEOSIDASE-RXN]] | ||
| + | * [[RXN-4315]] | ||
| + | * [[RXN0-361]] | ||
| + | * [[RXN0-363]] | ||
| + | * [[RXN0-366]] | ||
| + | * [[URIDINE-NUCLEOSIDASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-ribofuranose}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite D-Ribofuranose
- common-name:
- d-ribofuranose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- PURINE-NUCLEOSIDASE-RXN
- RIBOSYLPYRIMIDINE-NUCLEOSIDASE-RXN
- RXN-4315
- RXN0-361
- RXN0-363
- RXN0-366
- URIDINE-NUCLEOSIDASE-RXN
