Difference between revisions of "D-Ribofuranose"

Latest revision as of 11:15, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-11410 ==
+== Metabolite D-Ribofuranose ==
 * common-name:
-** triiodothyroacetate ether glucuronide
+** d-ribofuranose
-* smiles:
-** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c=c3))
-* inchi-key:
-** vxvbzmwowmhxtq-kfyubchvsa-l
-* molecular-weight:
-** 796.046
 == Reaction(s) known to consume the compound ==
+* [[RXN-4315]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-10619]]
+* [[PURINE-NUCLEOSIDASE-RXN]]
+* [[RIBOSYLPYRIMIDINE-NUCLEOSIDASE-RXN]]
+* [[RXN-4315]]
+* [[RXN0-361]]
+* [[RXN0-363]]
+* [[RXN0-366]]
+* [[URIDINE-NUCLEOSIDASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=triiodothyroacetate ether glucuronide}}
+{{#set: common-name=d-ribofuranose}}
-{{#set: inchi-key=inchikey=vxvbzmwowmhxtq-kfyubchvsa-l}}
-{{#set: molecular-weight=796.046}}